C14H27F3INO2Si — CID 22405495
N-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-iodoacetamide (PubChem CID 22405495) has the molecular formula C14H27F3INO2Si and a molecular weight of 453.36 g/mol. Its IUPAC name is N-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-iodoacetamide.
| Compound Name | N-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-iodoacetamide |
|---|---|
| PubChem CID | 22405495 |
| Molecular Formula | C14H27F3INO2Si |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]-2-iodoacetamide |
| SMILES | CC(C)C(CC(F)(F)F)(NC(=O)CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27F3INO2Si/c1-10(2)13(9-14(15,16)17,19-11(20)8-18)21-22(6,7)12(3,4)5/h10H,8-9H2,1-7H3,(H,19,20) |
| InChIKey | YEXZYJKWSXHFRT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|