C27H25F3N4O6 — CID 22405561
2-(4-nitrophenyl)-N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-6-phenyl-3-pyridinyl]acetamide (PubChem CID 22405561) has the molecular formula C27H25F3N4O6 and a molecular weight of 558.51 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-6-phenyl-3-pyridinyl]acetamide.
| Compound Name | 2-(4-nitrophenyl)-N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-6-phenyl-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 22405561 |
| Molecular Formula | C27H25F3N4O6 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 2-(4-nitrophenyl)-N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-6-phenyl-3-pyridinyl]acetamide |
| SMILES | CC(C)C(NC(=O)Cn1c(-c2ccccc2)ccc(NC(=O)Cc2ccc([N+](=O)[O-])cc2)c1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C27H25F3N4O6/c1-16(2)24(25(37)27(28,29)30)32-23(36)15-33-21(18-6-4-3-5-7-18)13-12-20(26(33)38)31-22(35)14-17-8-10-19(11-9-17)34(39)40/h3-13,16,24H,14-15H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | DCTIHQHXPXRLOO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|