C17H22F2O4 — CID 22406472
(2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 22406472) has the molecular formula C17H22F2O4 and a molecular weight of 328.36 g/mol. Its IUPAC name is (2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 22406472 |
| Molecular Formula | C17H22F2O4 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2Z,4E)-5-[7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(=C/C(=O)O)/C=C/C1C(C(F)F)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C17H22F2O4/c1-11(8-14(20)21)4-5-13-12(15(18)19)9-17(10-16(13,2)3)22-6-7-23-17/h4-5,8-9,13,15H,6-7,10H2,1-3H3,(H,20,21)/b5-4+,11-8- |
| InChIKey | DGRSCOLJENIWNY-LSHNQJRFSA-N |
| XLogP | 3.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|