About 2-hexyl-1,3-thiazole-5-sulfonamide
2-hexyl-1,3-thiazole-5-sulfonamide (PubChem CID 22406929) has the molecular formula C9H16N2O2S2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-hexyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-hexyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 22406929 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-hexyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCCCCCc1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-2-3-4-5-6-8-11-7-9(14-8)15(10,12)13/h7H,2-6H2,1H3,(H2,10,12,13) |
| InChIKey | WMVNWOJAPBGZRX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-hexyl-1,3-thiazole-5-sulfonamide (CID 22406929) is 2-hexyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-hexyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-hexyl-1,3-thiazole-5-sulfonamide is CCCCCCc1ncc(S(N)(=O)=O)s1.
What is the InChIKey of 2-hexyl-1,3-thiazole-5-sulfonamide?
The InChIKey is WMVNWOJAPBGZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S2/c1-2-3-4-5-6-8-11-7-9(14-8)15(10,12)13/h7H,2-6H2,1H3,(H2,10,12,13).
What are the key properties of 2-hexyl-1,3-thiazole-5-sulfonamide?
2-hexyl-1,3-thiazole-5-sulfonamide has a molecular weight of 248.37 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 22406929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).