About 2-butoxy-1,3-thiazole-5-sulfonamide
2-butoxy-1,3-thiazole-5-sulfonamide (PubChem CID 22406976) has the molecular formula C7H12N2O3S2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-butoxy-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-butoxy-1,3-thiazole-5-sulfonamide |
| PubChem CID | 22406976 |
| Molecular Formula | C7H12N2O3S2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-butoxy-1,3-thiazole-5-sulfonamide |
| SMILES | CCCCOc1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H12N2O3S2/c1-2-3-4-12-7-9-5-6(13-7)14(8,10)11/h5H,2-4H2,1H3,(H2,8,10,11) |
| InChIKey | OTHQZTCWPXITPV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-butoxy-1,3-thiazole-5-sulfonamide (CID 22406976) is 2-butoxy-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-butoxy-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-butoxy-1,3-thiazole-5-sulfonamide is CCCCOc1ncc(S(N)(=O)=O)s1.
What is the InChIKey of 2-butoxy-1,3-thiazole-5-sulfonamide?
The InChIKey is OTHQZTCWPXITPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S2/c1-2-3-4-12-7-9-5-6(13-7)14(8,10)11/h5H,2-4H2,1H3,(H2,8,10,11).
What are the key properties of 2-butoxy-1,3-thiazole-5-sulfonamide?
2-butoxy-1,3-thiazole-5-sulfonamide has a molecular weight of 236.32 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 22406976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).