About 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide
2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide (PubChem CID 22406988) has the molecular formula C7H13N3O4S3
and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide.
Molecular Properties
| Compound Name | 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide |
| PubChem CID | 22406988 |
| Molecular Formula | C7H13N3O4S3 |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H13N3O4S3/c1-7(2,3)10-17(13,14)6-9-4-5(15-6)16(8,11)12/h4,10H,1-3H3,(H2,8,11,12) |
| InChIKey | HHEGSKWQAUQOPK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide?
The IUPAC name of 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide (CID 22406988) is 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide.
What is the SMILES notation for 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide?
The canonical SMILES for 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide is CC(C)(C)NS(=O)(=O)c1ncc(S(N)(=O)=O)s1.
What is the InChIKey of 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide?
The InChIKey is HHEGSKWQAUQOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O4S3/c1-7(2,3)10-17(13,14)6-9-4-5(15-6)16(8,11)12/h4,10H,1-3H3,(H2,8,11,12).
What are the key properties of 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide?
2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide has a molecular weight of 299.40 g/mol, XLogP of -0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-tert-butyl-1,3-thiazole-2,5-disulfonamide is sourced from PubChem (CID 22406988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).