About 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide
2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide (PubChem CID 22406996) has the molecular formula C7H10N2O5S2
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide |
| PubChem CID | 22406996 |
| Molecular Formula | C7H10N2O5S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide |
| SMILES | COCOCC(=O)c1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C7H10N2O5S2/c1-13-4-14-3-5(10)7-9-2-6(15-7)16(8,11)12/h2H,3-4H2,1H3,(H2,8,11,12) |
| InChIKey | LWPJGRCKAXMFGF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide (CID 22406996) is 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide is COCOCC(=O)c1ncc(S(N)(=O)=O)s1.
What is the InChIKey of 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide?
The InChIKey is LWPJGRCKAXMFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O5S2/c1-13-4-14-3-5(10)7-9-2-6(15-7)16(8,11)12/h2H,3-4H2,1H3,(H2,8,11,12).
What are the key properties of 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide?
2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide has a molecular weight of 266.30 g/mol, XLogP of -0.41, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methoxymethoxy)acetyl]-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 22406996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).