C5Cl3F7O — CID 22407639
1,3,3-trichloro-1,1,4,4,5,5,5-heptafluoropentan-2-one (PubChem CID 22407639) has the molecular formula C5Cl3F7O and a molecular weight of 315.40 g/mol. Its IUPAC name is 1,3,3-trichloro-1,1,4,4,5,5,5-heptafluoropentan-2-one.
| Compound Name | 1,3,3-trichloro-1,1,4,4,5,5,5-heptafluoropentan-2-one |
|---|---|
| PubChem CID | 22407639 |
| Molecular Formula | C5Cl3F7O |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 313.89 |
| IUPAC Name | 1,3,3-trichloro-1,1,4,4,5,5,5-heptafluoropentan-2-one |
| SMILES | O=C(C(F)(F)Cl)C(Cl)(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5Cl3F7O/c6-2(7,1(16)3(8,9)10)4(11,12)5(13,14)15 |
| InChIKey | UGCJBHHZLJHSFL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|