C12H20N4S7 — CID 22407691
3-N,3-N,5-N,5-N-tetrakis(ethylsulfanyl)-1,2,4-thiadiazole-3,5-dicarbothioamide (PubChem CID 22407691) has the molecular formula C12H20N4S7 and a molecular weight of 444.79 g/mol. Its IUPAC name is 3-N,3-N,5-N,5-N-tetrakis(ethylsulfanyl)-1,2,4-thiadiazole-3,5-dicarbothioamide.
| Compound Name | 3-N,3-N,5-N,5-N-tetrakis(ethylsulfanyl)-1,2,4-thiadiazole-3,5-dicarbothioamide |
|---|---|
| PubChem CID | 22407691 |
| Molecular Formula | C12H20N4S7 |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | 3-N,3-N,5-N,5-N-tetrakis(ethylsulfanyl)-1,2,4-thiadiazole-3,5-dicarbothioamide |
| SMILES | CCSN(SCC)C(=S)c1nsc(C(=S)N(SCC)SCC)n1 |
| InChI | InChI=1S/C12H20N4S7/c1-5-19-15(20-6-2)11(17)9-13-10(23-14-9)12(18)16(21-7-3)22-8-4/h5-8H2,1-4H3 |
| InChIKey | LLHAAMMCDQOIJZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|