C21H38N2O7P+ — CID 22407918
[2-[8-(2-aminophenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium (PubChem CID 22407918) has the molecular formula C21H38N2O7P+ and a molecular weight of 461.52 g/mol. Its IUPAC name is [2-[8-(2-aminophenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium.
| Compound Name | [2-[8-(2-aminophenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 22407918 |
| Molecular Formula | C21H38N2O7P+ |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | [2-[8-(2-aminophenoxy)octoxy-hydroxyphosphoryl]oxy-3-carboxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OP(=O)(O)OCCCCCCCCOc1ccccc1N |
| InChI | InChI=1S/C21H37N2O7P/c1-23(2,3)17-18(16-21(24)25)30-31(26,27)29-15-11-7-5-4-6-10-14-28-20-13-9-8-12-19(20)22/h8-9,12-13,18H,4-7,10-11,14-17,22H2,1-3H3,(H-,24,25,26,27)/p+1 |
| InChIKey | COTIVENRKYQGKG-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|