About ethanolate;tetrapropylazanium
ethanolate;tetrapropylazanium (PubChem CID 22408927) has the molecular formula C14H33NO
and a molecular weight of 231.42 g/mol. Its IUPAC name is ethanolate;tetrapropylazanium.
Molecular Properties
| Compound Name | ethanolate;tetrapropylazanium |
| PubChem CID | 22408927 |
| Molecular Formula | C14H33NO |
| Molecular Weight | 231.42 g/mol |
| Exact Mass | 231.26 |
| IUPAC Name | ethanolate;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.CC[O-] |
| InChI | InChI=1S/C12H28N.C2H5O/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-2-3/h5-12H2,1-4H3;2H2,1H3/q+1;-1 |
| InChIKey | PHYUPPGDMDNUMZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;tetrapropylazanium?
The IUPAC name of ethanolate;tetrapropylazanium (CID 22408927) is ethanolate;tetrapropylazanium.
What is the SMILES notation for ethanolate;tetrapropylazanium?
The canonical SMILES for ethanolate;tetrapropylazanium is CCC[N+](CCC)(CCC)CCC.CC[O-].
What is the InChIKey of ethanolate;tetrapropylazanium?
The InChIKey is PHYUPPGDMDNUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.C2H5O/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-2-3/h5-12H2,1-4H3;2H2,1H3/q+1;-1.
What are the key properties of ethanolate;tetrapropylazanium?
ethanolate;tetrapropylazanium has a molecular weight of 231.42 g/mol, XLogP of 2.81, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;tetrapropylazanium is sourced from PubChem (CID 22408927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).