About [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate
[4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate (PubChem CID 2240944) has the molecular formula C26H22O8
and a molecular weight of 462.45 g/mol. Its IUPAC name is [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate.
Molecular Properties
| Compound Name | [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate |
| PubChem CID | 2240944 |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccc2oc(-c3cc(OC)c(OC)c(OC)c3)cc(=O)c2c1 |
| InChI | InChI=1S/C26H22O8/c1-29-20-8-6-5-7-17(20)26(28)33-16-9-10-21-18(13-16)19(27)14-22(34-21)15-11-23(30-2)25(32-4)24(12-15)31-3/h5-14H,1-4H3 |
| InChIKey | CYPGFCFTRWEDBD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate?
The IUPAC name of [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate (CID 2240944) is [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate.
What is the SMILES notation for [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate?
The canonical SMILES for [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate is COc1ccccc1C(=O)Oc1ccc2oc(-c3cc(OC)c(OC)c(OC)c3)cc(=O)c2c1.
What is the InChIKey of [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate?
The InChIKey is CYPGFCFTRWEDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22O8/c1-29-20-8-6-5-7-17(20)26(28)33-16-9-10-21-18(13-16)19(27)14-22(34-21)15-11-23(30-2)25(32-4)24(12-15)31-3/h5-14H,1-4H3.
What are the key properties of [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate?
[4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate has a molecular weight of 462.45 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-6-yl] 2-methoxybenzoate is sourced from PubChem (CID 2240944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).