C28H26F2N4O3 — CID 22409463
3-[5-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409463) has the molecular formula C28H26F2N4O3 and a molecular weight of 504.54 g/mol. Its IUPAC name is 3-[5-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[5-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409463 |
| Molecular Formula | C28H26F2N4O3 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 3-[5-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(5-fluoro-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CC(O)CN3CCCCC3)c3ccc(F)cc23)=C1c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C28H26F2N4O3/c29-16-4-6-23-19(10-16)21(12-31-23)25-26(28(37)32-27(25)36)22-15-34(24-7-5-17(30)11-20(22)24)14-18(35)13-33-8-2-1-3-9-33/h4-7,10-12,15,18,31,35H,1-3,8-9,13-14H2,(H,32,36,37) |
| InChIKey | SAMJUECYLWNMEQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|