C28H27FN4O3 — CID 22409625
3-[6-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 22409625) has the molecular formula C28H27FN4O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is 3-[6-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[6-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22409625 |
| Molecular Formula | C28H27FN4O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 3-[6-fluoro-1-(2-hydroxy-3-piperidin-1-ylpropyl)indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CC(O)CN3CCCCC3)c3cc(F)ccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H27FN4O3/c29-17-8-9-20-22(16-33(24(20)12-17)15-18(34)14-32-10-4-1-5-11-32)26-25(27(35)31-28(26)36)21-13-30-23-7-3-2-6-19(21)23/h2-3,6-9,12-13,16,18,30,34H,1,4-5,10-11,14-15H2,(H,31,35,36) |
| InChIKey | BAZPJLJIGPLPPZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|