C29H32N4O6 — CID 22410220
3-(5,6-dimethoxy-1H-indol-3-yl)-4-[1-[3-(dimethylamino)propyl]-5,6-dimethoxyindol-3-yl]pyrrole-2,5-dione (PubChem CID 22410220) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 3-(5,6-dimethoxy-1H-indol-3-yl)-4-[1-[3-(dimethylamino)propyl]-5,6-dimethoxyindol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(5,6-dimethoxy-1H-indol-3-yl)-4-[1-[3-(dimethylamino)propyl]-5,6-dimethoxyindol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410220 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 3-(5,6-dimethoxy-1H-indol-3-yl)-4-[1-[3-(dimethylamino)propyl]-5,6-dimethoxyindol-3-yl]pyrrole-2,5-dione |
| SMILES | COc1cc2[nH]cc(C3=C(c4cn(CCCN(C)C)c5cc(OC)c(OC)cc45)C(=O)NC3=O)c2cc1OC |
| InChI | InChI=1S/C29H32N4O6/c1-32(2)8-7-9-33-15-19(17-11-23(37-4)25(39-6)13-21(17)33)27-26(28(34)31-29(27)35)18-14-30-20-12-24(38-5)22(36-3)10-16(18)20/h10-15,30H,7-9H2,1-6H3,(H,31,34,35) |
| InChIKey | IYUCHOIJDJTSSR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|