C25H18N4O4S — CID 22410576
3-(1H-indol-3-yl)-4-[6-(3-isothiocyanatopropyl)-[1,3]dioxolo[4,5-e]indol-8-yl]pyrrole-2,5-dione (PubChem CID 22410576) has the molecular formula C25H18N4O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[6-(3-isothiocyanatopropyl)-[1,3]dioxolo[4,5-e]indol-8-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-[6-(3-isothiocyanatopropyl)-[1,3]dioxolo[4,5-e]indol-8-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22410576 |
| Molecular Formula | C25H18N4O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[6-(3-isothiocyanatopropyl)-[1,3]dioxolo[4,5-e]indol-8-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN=C=S)c3ccc4c(c23)OCO4)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H18N4O4S/c30-24-21(15-10-27-17-5-2-1-4-14(15)17)22(25(31)28-24)16-11-29(9-3-8-26-12-34)18-6-7-19-23(20(16)18)33-13-32-19/h1-2,4-7,10-11,27H,3,8-9,13H2,(H,28,30,31) |
| InChIKey | DYHVLRVUHSDSIS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|