About N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide
N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide (PubChem CID 2241120) has the molecular formula C13H18N3O2S+
and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide.
Molecular Properties
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
| PubChem CID | 2241120 |
| Molecular Formula | C13H18N3O2S+ |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide |
| SMILES | C[C@@H]1C[NH+](CC(=O)Nc2sccc2C#N)C[C@H](C)O1 |
| InChI | InChI=1S/C13H17N3O2S/c1-9-6-16(7-10(2)18-9)8-12(17)15-13-11(5-14)3-4-19-13/h3-4,9-10H,6-8H2,1-2H3,(H,15,17)/p+1/t9-,10+ |
| InChIKey | JWJHVRLALUGUFI-AOOOYVTPSA-O |
| XLogP | 0.25 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide?
The IUPAC name of N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide (CID 2241120) is N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide.
What is the SMILES notation for N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide?
The canonical SMILES for N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide is C[C@@H]1C[NH+](CC(=O)Nc2sccc2C#N)C[C@H](C)O1.
What is the InChIKey of N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide?
The InChIKey is JWJHVRLALUGUFI-AOOOYVTPSA-O. The full InChI is InChI=1S/C13H17N3O2S/c1-9-6-16(7-10(2)18-9)8-12(17)15-13-11(5-14)3-4-19-13/h3-4,9-10H,6-8H2,1-2H3,(H,15,17)/p+1/t9-,10+.
What are the key properties of N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide?
N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide has a molecular weight of 280.37 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyanothiophen-2-yl)-2-[(2R,6S)-2,6-dimethylmorpholin-4-ium-4-yl]acetamide is sourced from PubChem (CID 2241120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).