C16H18N2O4S — CID 2241236
furan-2-yl-[4-(3-methylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 2241236) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is furan-2-yl-[4-(3-methylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(3-methylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2241236 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | furan-2-yl-[4-(3-methylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cccc(S(=O)(=O)N2CCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-13-4-2-5-14(12-13)23(20,21)18-9-7-17(8-10-18)16(19)15-6-3-11-22-15/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | YKRHRZCNEHKYFC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |