C25H26FNO2 — CID 22412416
(E)-1-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]hept-1-ene-3,5-diol (PubChem CID 22412416) has the molecular formula C25H26FNO2 and a molecular weight of 391.49 g/mol. Its IUPAC name is (E)-1-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]hept-1-ene-3,5-diol.
| Compound Name | (E)-1-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]hept-1-ene-3,5-diol |
|---|---|
| PubChem CID | 22412416 |
| Molecular Formula | C25H26FNO2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (E)-1-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]hept-1-ene-3,5-diol |
| SMILES | CCC(O)CC(O)/C=C/c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FNO2/c1-2-19(28)15-20(29)13-14-22-24(16-9-11-18(26)12-10-16)21-5-3-4-6-23(21)27-25(22)17-7-8-17/h3-6,9-14,17,19-20,28-29H,2,7-8,15H2,1H3/b14-13+ |
| InChIKey | WKPZUCBZSGJGMI-BUHFOSPRSA-N |
| XLogP | 5.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |