About CID 22412651
CID 22412651 (PubChem CID 22412651) has the molecular formula C28H45N3O3Si
and a molecular weight of 499.77 g/mol.
Molecular Properties
| Compound Name | CID 22412651 |
| PubChem CID | 22412651 |
| Molecular Formula | C28H45N3O3Si |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | — |
| SMILES | CCCCOCCCCOc1cnc(-c2cccnc2O[Si]CCCCC(C)(C)CCCC)cn1 |
| InChI | InChI=1S/C28H45N3O3Si/c1-5-7-15-28(3,4)16-9-12-21-35-34-27-24(14-13-17-29-27)25-22-31-26(23-30-25)33-20-11-10-19-32-18-8-6-2/h13-14,17,22-23H,5-12,15-16,18-21H2,1-4H3 |
| InChIKey | MYXPDUUPDYEQAJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22412651 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22412651?
The IUPAC name of CID 22412651 (CID 22412651) is not available.
What is the SMILES notation for CID 22412651?
The canonical SMILES for CID 22412651 is CCCCOCCCCOc1cnc(-c2cccnc2O[Si]CCCCC(C)(C)CCCC)cn1.
What is the InChIKey of CID 22412651?
The InChIKey is MYXPDUUPDYEQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45N3O3Si/c1-5-7-15-28(3,4)16-9-12-21-35-34-27-24(14-13-17-29-27)25-22-31-26(23-30-25)33-20-11-10-19-32-18-8-6-2/h13-14,17,22-23H,5-12,15-16,18-21H2,1-4H3.
What are the key properties of CID 22412651?
CID 22412651 has a molecular weight of 499.77 g/mol, XLogP of 7.32, 20 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22412651 is sourced from PubChem (CID 22412651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).