About CID 22412853
CID 22412853 (PubChem CID 22412853) has the molecular formula C31H51N3O2Si2
and a molecular weight of 553.94 g/mol.
Molecular Properties
| Compound Name | CID 22412853 |
| PubChem CID | 22412853 |
| Molecular Formula | C31H51N3O2Si2 |
| Molecular Weight | 553.94 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | — |
| SMILES | CCCCC(C)CCC(C)C[Si]Oc1ccc(-c2ncccc2O[Si]CCCC(C)C(C)CCCC)nn1 |
| InChI | InChI=1S/C31H51N3O2Si2/c1-7-9-13-24(3)17-18-25(4)23-38-36-30-20-19-28(33-34-30)31-29(16-11-21-32-31)35-37-22-12-15-27(6)26(5)14-10-8-2/h11,16,19-21,24-27H,7-10,12-15,17-18,22-23H2,1-6H3 |
| InChIKey | YGYLXZUAPQUCAT-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.94 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22412853 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22412853?
The IUPAC name of CID 22412853 (CID 22412853) is not available.
What is the SMILES notation for CID 22412853?
The canonical SMILES for CID 22412853 is CCCCC(C)CCC(C)C[Si]Oc1ccc(-c2ncccc2O[Si]CCCC(C)C(C)CCCC)nn1.
What is the InChIKey of CID 22412853?
The InChIKey is YGYLXZUAPQUCAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H51N3O2Si2/c1-7-9-13-24(3)17-18-25(4)23-38-36-30-20-19-28(33-34-30)31-29(16-11-21-32-31)35-37-22-12-15-27(6)26(5)14-10-8-2/h11,16,19-21,24-27H,7-10,12-15,17-18,22-23H2,1-6H3.
What are the key properties of CID 22412853?
CID 22412853 has a molecular weight of 553.94 g/mol, XLogP of 8.86, 21 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22412853 is sourced from PubChem (CID 22412853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).