C34H50N4O2 — CID 22412878
2,5-bis[5-(4-hexoxybutyl)-2-pyridinyl]pyrazine (PubChem CID 22412878) has the molecular formula C34H50N4O2 and a molecular weight of 546.80 g/mol. Its IUPAC name is 2,5-bis[5-(4-hexoxybutyl)-2-pyridinyl]pyrazine.
| Compound Name | 2,5-bis[5-(4-hexoxybutyl)-2-pyridinyl]pyrazine |
|---|---|
| PubChem CID | 22412878 |
| Molecular Formula | C34H50N4O2 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | 2,5-bis[5-(4-hexoxybutyl)-2-pyridinyl]pyrazine |
| SMILES | CCCCCCOCCCCc1ccc(-c2cnc(-c3ccc(CCCCOCCCCCC)cn3)cn2)nc1 |
| InChI | InChI=1S/C34H50N4O2/c1-3-5-7-11-21-39-23-13-9-15-29-17-19-31(35-25-29)33-27-38-34(28-37-33)32-20-18-30(26-36-32)16-10-14-24-40-22-12-8-6-4-2/h17-20,25-28H,3-16,21-24H2,1-2H3 |
| InChIKey | NQNCZIQBUFQCEF-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|