C25H24F15N3O2 — CID 22412928
3-(6-octoxy-3-pyridinyl)-6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)pyridazine (PubChem CID 22412928) has the molecular formula C25H24F15N3O2 and a molecular weight of 683.46 g/mol. Its IUPAC name is 3-(6-octoxy-3-pyridinyl)-6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)pyridazine.
| Compound Name | 3-(6-octoxy-3-pyridinyl)-6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)pyridazine |
|---|---|
| PubChem CID | 22412928 |
| Molecular Formula | C25H24F15N3O2 |
| Molecular Weight | 683.46 g/mol |
| Exact Mass | 683.16 |
| IUPAC Name | 3-(6-octoxy-3-pyridinyl)-6-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)pyridazine |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn2)cn1 |
| InChI | InChI=1S/C25H24F15N3O2/c1-2-3-4-5-6-7-12-44-17-10-8-15(13-41-17)16-9-11-18(43-42-16)45-14-19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)40/h8-11,13H,2-7,12,14H2,1H3 |
| InChIKey | RRBCUURJPZQQBA-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.46 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|