About 3,4-diphenylmorpholine
3,4-diphenylmorpholine (PubChem CID 22413504) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is 3,4-diphenylmorpholine.
Molecular Properties
| Compound Name | 3,4-diphenylmorpholine |
| PubChem CID | 22413504 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3,4-diphenylmorpholine |
| SMILES | c1ccc(C2COCCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO/c1-3-7-14(8-4-1)16-13-18-12-11-17(16)15-9-5-2-6-10-15/h1-10,16H,11-13H2 |
| InChIKey | GVUTXXITQVPMAA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-diphenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diphenylmorpholine?
The IUPAC name of 3,4-diphenylmorpholine (CID 22413504) is 3,4-diphenylmorpholine.
What is the SMILES notation for 3,4-diphenylmorpholine?
The canonical SMILES for 3,4-diphenylmorpholine is c1ccc(C2COCCN2c2ccccc2)cc1.
What is the InChIKey of 3,4-diphenylmorpholine?
The InChIKey is GVUTXXITQVPMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-3-7-14(8-4-1)16-13-18-12-11-17(16)15-9-5-2-6-10-15/h1-10,16H,11-13H2.
What are the key properties of 3,4-diphenylmorpholine?
3,4-diphenylmorpholine has a molecular weight of 239.32 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diphenylmorpholine is sourced from PubChem (CID 22413504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).