About 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one
7-fluoro-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 22413775) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 22413775 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FNO/c1-12-9-6-8(11)4-2-7(9)3-5-10(12)13/h2,4,6H,3,5H2,1H3 |
| InChIKey | ZHZRLOXSTPINQH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one (CID 22413775) is 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one is CN1C(=O)CCc2ccc(F)cc21.
What is the InChIKey of 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one?
The InChIKey is ZHZRLOXSTPINQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c1-12-9-6-8(11)4-2-7(9)3-5-10(12)13/h2,4,6H,3,5H2,1H3.
What are the key properties of 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one?
7-fluoro-1-methyl-3,4-dihydroquinolin-2-one has a molecular weight of 179.19 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-methyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 22413775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).