About 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine
2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine (PubChem CID 22413804) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine.
Analyze 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine (CID 22413804) is 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine is C1=CNC2NCNC2=C1.
What is the InChIKey of 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine?
The InChIKey is FOCKIYZLSZKVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-2-5-6(7-3-1)9-4-8-5/h1-3,6-9H,4H2.
What are the key properties of 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine?
2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine has a molecular weight of 123.16 g/mol, XLogP of -0.54, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3a,4-tetrahydro-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 22413804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).