C12H23N2O3+ — CID 22413879
1-carboxyethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium (PubChem CID 22413879) has the molecular formula C12H23N2O3+ and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-carboxyethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium.
| Compound Name | 1-carboxyethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 22413879 |
| Molecular Formula | C12H23N2O3+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-carboxyethyl-dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C(C)C(=O)O |
| InChI | InChI=1S/C12H22N2O3/c1-9(2)11(15)13-7-6-8-14(4,5)10(3)12(16)17/h10H,1,6-8H2,2-5H3,(H-,13,15,16,17)/p+1 |
| InChIKey | CCCUTSQUGDTKBB-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|