About 2-prop-1-ynylbenzamide
2-prop-1-ynylbenzamide (PubChem CID 22414186) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-prop-1-ynylbenzamide.
Molecular Properties
| Compound Name | 2-prop-1-ynylbenzamide |
| PubChem CID | 22414186 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-prop-1-ynylbenzamide |
| SMILES | CC#Cc1ccccc1C(N)=O |
| InChI | InChI=1S/C10H9NO/c1-2-5-8-6-3-4-7-9(8)10(11)12/h3-4,6-7H,1H3,(H2,11,12) |
| InChIKey | UURDEBPGOSLCQJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-ynylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-ynylbenzamide?
The IUPAC name of 2-prop-1-ynylbenzamide (CID 22414186) is 2-prop-1-ynylbenzamide.
What is the SMILES notation for 2-prop-1-ynylbenzamide?
The canonical SMILES for 2-prop-1-ynylbenzamide is CC#Cc1ccccc1C(N)=O.
What is the InChIKey of 2-prop-1-ynylbenzamide?
The InChIKey is UURDEBPGOSLCQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c1-2-5-8-6-3-4-7-9(8)10(11)12/h3-4,6-7H,1H3,(H2,11,12).
What are the key properties of 2-prop-1-ynylbenzamide?
2-prop-1-ynylbenzamide has a molecular weight of 159.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-ynylbenzamide is sourced from PubChem (CID 22414186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).