About 4-propoxybutanamide
4-propoxybutanamide (PubChem CID 22414190) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-propoxybutanamide.
Molecular Properties
| Compound Name | 4-propoxybutanamide |
| PubChem CID | 22414190 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 4-propoxybutanamide |
| SMILES | CCCOCCCC(N)=O |
| InChI | InChI=1S/C7H15NO2/c1-2-5-10-6-3-4-7(8)9/h2-6H2,1H3,(H2,8,9) |
| InChIKey | FMUQSTVQFMLCRS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-propoxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxybutanamide?
The IUPAC name of 4-propoxybutanamide (CID 22414190) is 4-propoxybutanamide.
What is the SMILES notation for 4-propoxybutanamide?
The canonical SMILES for 4-propoxybutanamide is CCCOCCCC(N)=O.
What is the InChIKey of 4-propoxybutanamide?
The InChIKey is FMUQSTVQFMLCRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-2-5-10-6-3-4-7(8)9/h2-6H2,1H3,(H2,8,9).
What are the key properties of 4-propoxybutanamide?
4-propoxybutanamide has a molecular weight of 145.20 g/mol, XLogP of 0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxybutanamide is sourced from PubChem (CID 22414190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).