About 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine
4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine (PubChem CID 22414412) has the molecular formula C13H12N2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine.
Molecular Properties
| Compound Name | 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine |
| PubChem CID | 22414412 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine |
| SMILES | C1=NC(c2cccs2)Cc2ccccc2N1 |
| InChI | InChI=1S/C13H12N2S/c1-2-5-11-10(4-1)8-12(15-9-14-11)13-6-3-7-16-13/h1-7,9,12H,8H2,(H,14,15) |
| InChIKey | OMVMVEIBIXNDRD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine?
The IUPAC name of 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine (CID 22414412) is 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine.
What is the SMILES notation for 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine?
The canonical SMILES for 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine is C1=NC(c2cccs2)Cc2ccccc2N1.
What is the InChIKey of 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine?
The InChIKey is OMVMVEIBIXNDRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2S/c1-2-5-11-10(4-1)8-12(15-9-14-11)13-6-3-7-16-13/h1-7,9,12H,8H2,(H,14,15).
What are the key properties of 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine?
4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine has a molecular weight of 228.32 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-yl-4,5-dihydro-1H-1,3-benzodiazepine is sourced from PubChem (CID 22414412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).