About bis(3,5-difluorophenyl)phosphinite
bis(3,5-difluorophenyl)phosphinite (PubChem CID 22415861) has the molecular formula C12H6F4OP-
and a molecular weight of 273.14 g/mol. Its IUPAC name is bis(3,5-difluorophenyl)phosphinite.
Molecular Properties
| Compound Name | bis(3,5-difluorophenyl)phosphinite |
| PubChem CID | 22415861 |
| Molecular Formula | C12H6F4OP- |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | bis(3,5-difluorophenyl)phosphinite |
| SMILES | [O-]P(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H6F4OP/c13-7-1-8(14)4-11(3-7)18(17)12-5-9(15)2-10(16)6-12/h1-6H/q-1 |
| InChIKey | IURZWOLKMJCKHK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(3,5-difluorophenyl)phosphinite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,5-difluorophenyl)phosphinite?
The IUPAC name of bis(3,5-difluorophenyl)phosphinite (CID 22415861) is bis(3,5-difluorophenyl)phosphinite.
What is the SMILES notation for bis(3,5-difluorophenyl)phosphinite?
The canonical SMILES for bis(3,5-difluorophenyl)phosphinite is [O-]P(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1.
What is the InChIKey of bis(3,5-difluorophenyl)phosphinite?
The InChIKey is IURZWOLKMJCKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F4OP/c13-7-1-8(14)4-11(3-7)18(17)12-5-9(15)2-10(16)6-12/h1-6H/q-1.
What are the key properties of bis(3,5-difluorophenyl)phosphinite?
bis(3,5-difluorophenyl)phosphinite has a molecular weight of 273.14 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-difluorophenyl)phosphinite is sourced from PubChem (CID 22415861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).