C25H22N2O2S2 — CID 2241599
1-(4-phenoxyphenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-3-ylsulfanyl)ethanone (PubChem CID 2241599) has the molecular formula C25H22N2O2S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-3-ylsulfanyl)ethanone.
| Compound Name | 1-(4-phenoxyphenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 2241599 |
| Molecular Formula | C25H22N2O2S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 1-(4-phenoxyphenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-3-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1ncnc2sc3c(c12)CCCCC3)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O2S2/c28-21(17-11-13-19(14-12-17)29-18-7-3-1-4-8-18)15-30-24-23-20-9-5-2-6-10-22(20)31-25(23)27-16-26-24/h1,3-4,7-8,11-14,16H,2,5-6,9-10,15H2 |
| InChIKey | LUZBLYQAISCTOK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |