About 2,6-dichlorohexanal
2,6-dichlorohexanal (PubChem CID 22416682) has the molecular formula C6H10Cl2O
and a molecular weight of 169.05 g/mol. Its IUPAC name is 2,6-dichlorohexanal.
Molecular Properties
| Compound Name | 2,6-dichlorohexanal |
| PubChem CID | 22416682 |
| Molecular Formula | C6H10Cl2O |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 2,6-dichlorohexanal |
| SMILES | O=CC(Cl)CCCCCl |
| InChI | InChI=1S/C6H10Cl2O/c7-4-2-1-3-6(8)5-9/h5-6H,1-4H2 |
| InChIKey | LLYAEKIWMMKVAA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichlorohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorohexanal?
The IUPAC name of 2,6-dichlorohexanal (CID 22416682) is 2,6-dichlorohexanal.
What is the SMILES notation for 2,6-dichlorohexanal?
The canonical SMILES for 2,6-dichlorohexanal is O=CC(Cl)CCCCCl.
What is the InChIKey of 2,6-dichlorohexanal?
The InChIKey is LLYAEKIWMMKVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2O/c7-4-2-1-3-6(8)5-9/h5-6H,1-4H2.
What are the key properties of 2,6-dichlorohexanal?
2,6-dichlorohexanal has a molecular weight of 169.05 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorohexanal is sourced from PubChem (CID 22416682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).