C16H23NS — CID 22417022
2-methyl-4-(4-methylsulfanylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 22417022) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 2-methyl-4-(4-methylsulfanylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 2-methyl-4-(4-methylsulfanylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 22417022 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-methyl-4-(4-methylsulfanylphenyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CSc1ccc(C2CCCC3CN(C)CC32)cc1 |
| InChI | InChI=1S/C16H23NS/c1-17-10-13-4-3-5-15(16(13)11-17)12-6-8-14(18-2)9-7-12/h6-9,13,15-16H,3-5,10-11H2,1-2H3 |
| InChIKey | CLLHTPRQRDIWIR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |