About 6-azaspiro[3.5]nonane
6-azaspiro[3.5]nonane (PubChem CID 22417100) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is 6-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 6-azaspiro[3.5]nonane |
| PubChem CID | 22417100 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 6-azaspiro[3.5]nonane |
| SMILES | C1CNCC2(C1)CCC2 |
| InChI | InChI=1S/C8H15N/c1-3-8(4-1)5-2-6-9-7-8/h9H,1-7H2 |
| InChIKey | OSWZGWQDPZSXLZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azaspiro[3.5]nonane?
The IUPAC name of 6-azaspiro[3.5]nonane (CID 22417100) is 6-azaspiro[3.5]nonane.
What is the SMILES notation for 6-azaspiro[3.5]nonane?
The canonical SMILES for 6-azaspiro[3.5]nonane is C1CNCC2(C1)CCC2.
What is the InChIKey of 6-azaspiro[3.5]nonane?
The InChIKey is OSWZGWQDPZSXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-3-8(4-1)5-2-6-9-7-8/h9H,1-7H2.
What are the key properties of 6-azaspiro[3.5]nonane?
6-azaspiro[3.5]nonane has a molecular weight of 125.22 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azaspiro[3.5]nonane is sourced from PubChem (CID 22417100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).