C18H18F2N4O3 — CID 22417161
5-amino-7-(4,7-diazaspiro[2.5]octan-7-yl)-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 22417161) has the molecular formula C18H18F2N4O3 and a molecular weight of 376.36 g/mol. Its IUPAC name is 5-amino-7-(4,7-diazaspiro[2.5]octan-7-yl)-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-7-(4,7-diazaspiro[2.5]octan-7-yl)-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22417161 |
| Molecular Formula | C18H18F2N4O3 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 5-amino-7-(4,7-diazaspiro[2.5]octan-7-yl)-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | C=Cn1cc(C(=O)O)c(=O)c2c(N)c(F)c(N3CCNC4(CC4)C3)c(F)c21 |
| InChI | InChI=1S/C18H18F2N4O3/c1-2-23-7-9(17(26)27)16(25)10-13(21)11(19)15(12(20)14(10)23)24-6-5-22-18(8-24)3-4-18/h2,7,22H,1,3-6,8,21H2,(H,26,27) |
| InChIKey | MGQFFJDGNPVVAE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|