About 4,7-epoxyisoindole-1,3-dione
4,7-epoxyisoindole-1,3-dione (PubChem CID 22417302) has the molecular formula C8H3NO3
and a molecular weight of 161.12 g/mol. Its IUPAC name is 4,7-epoxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | 4,7-epoxyisoindole-1,3-dione |
| PubChem CID | 22417302 |
| Molecular Formula | C8H3NO3 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1c1ccc2o1 |
| InChI | InChI=1S/C8H3NO3/c10-7-5-3-1-2-4(12-3)6(5)8(11)9-7/h1-2H,(H,9,10,11) |
| InChIKey | FLPYEIFCSKVDIM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4,7-epoxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-epoxyisoindole-1,3-dione?
The IUPAC name of 4,7-epoxyisoindole-1,3-dione (CID 22417302) is 4,7-epoxyisoindole-1,3-dione.
What is the SMILES notation for 4,7-epoxyisoindole-1,3-dione?
The canonical SMILES for 4,7-epoxyisoindole-1,3-dione is O=C1NC(=O)c2c1c1ccc2o1.
What is the InChIKey of 4,7-epoxyisoindole-1,3-dione?
The InChIKey is FLPYEIFCSKVDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3NO3/c10-7-5-3-1-2-4(12-3)6(5)8(11)9-7/h1-2H,(H,9,10,11).
What are the key properties of 4,7-epoxyisoindole-1,3-dione?
4,7-epoxyisoindole-1,3-dione has a molecular weight of 161.12 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-epoxyisoindole-1,3-dione is sourced from PubChem (CID 22417302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).