C30H33F3N4O4 — CID 22417358
3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 22417358) has the molecular formula C30H33F3N4O4 and a molecular weight of 570.61 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 22417358 |
| Molecular Formula | C30H33F3N4O4 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 3-(diaminomethylideneamino)-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOc1ccc(NC(=O)c3cccc(N=C(N)N)c3)cc1C(F)(F)F)O2 |
| InChI | InChI=1S/C30H33F3N4O4/c1-16-17(2)26-22(18(3)25(16)38)10-11-29(4,41-26)12-13-40-24-9-8-21(15-23(24)30(31,32)33)36-27(39)19-6-5-7-20(14-19)37-28(34)35/h5-9,14-15,38H,10-13H2,1-4H3,(H,36,39)(H4,34,35,37) |
| InChIKey | LPLMAYNANRAPHR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|