C23H36O6 — CID 22417422
tert-butyl 2-[2-[6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate (PubChem CID 22417422) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is tert-butyl 2-[2-[6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 22417422 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | tert-butyl 2-[2-[6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]ethoxy]acetate |
| SMILES | COCOc1c(C)c(C)c2c(c1C)CCC(C)(CCOCC(=O)OC(C)(C)C)O2 |
| InChI | InChI=1S/C23H36O6/c1-15-16(2)21-18(17(3)20(15)27-14-25-8)9-10-23(7,29-21)11-12-26-13-19(24)28-22(4,5)6/h9-14H2,1-8H3 |
| InChIKey | GRMXYVIXYQTCKA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|