C25H32F3N3O3 — CID 22417444
2-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butoxy]-2-(trifluoromethyl)phenyl]guanidine (PubChem CID 22417444) has the molecular formula C25H32F3N3O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butoxy]-2-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 2-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butoxy]-2-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 22417444 |
| Molecular Formula | C25H32F3N3O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[4-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butoxy]-2-(trifluoromethyl)phenyl]guanidine |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCOc1ccc(N=C(N)N)c(C(F)(F)F)c1)O2 |
| InChI | InChI=1S/C25H32F3N3O3/c1-14-15(2)22-18(16(3)21(14)32)9-11-24(4,34-22)10-5-6-12-33-17-7-8-20(31-23(29)30)19(13-17)25(26,27)28/h7-8,13,32H,5-6,9-12H2,1-4H3,(H4,29,30,31) |
| InChIKey | VIAIQCDKHNFZLN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|