C25H36ClN5O3 — CID 22417445
1-[2-(diaminomethylideneamino)phenyl]-3-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butyl]urea;hydrochloride (PubChem CID 22417445) has the molecular formula C25H36ClN5O3 and a molecular weight of 490.05 g/mol. Its IUPAC name is 1-[2-(diaminomethylideneamino)phenyl]-3-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butyl]urea;hydrochloride.
| Compound Name | 1-[2-(diaminomethylideneamino)phenyl]-3-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butyl]urea;hydrochloride |
|---|---|
| PubChem CID | 22417445 |
| Molecular Formula | C25H36ClN5O3 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-[2-(diaminomethylideneamino)phenyl]-3-[4-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)butyl]urea;hydrochloride |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCNC(=O)Nc1ccccc1N=C(N)N)O2.Cl |
| InChI | InChI=1S/C25H35N5O3.ClH/c1-15-16(2)22-18(17(3)21(15)31)11-13-25(4,33-22)12-7-8-14-28-24(32)30-20-10-6-5-9-19(20)29-23(26)27;/h5-6,9-10,31H,7-8,11-14H2,1-4H3,(H4,26,27,29)(H2,28,30,32);1H |
| InChIKey | BYTNJDACAMVYKE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|