About 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine
4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine (PubChem CID 22417877) has the molecular formula C21H15F2N3
and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine |
| PubChem CID | 22417877 |
| Molecular Formula | C21H15F2N3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine |
| SMILES | Nc1ccc2nc(-c3ccccc3)cc(Nc3ccc(F)c(F)c3)c2c1 |
| InChI | InChI=1S/C21H15F2N3/c22-17-8-7-15(11-18(17)23)25-21-12-20(13-4-2-1-3-5-13)26-19-9-6-14(24)10-16(19)21/h1-12H,24H2,(H,25,26) |
| InChIKey | BFHDIFIBCIIWMY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine?
The IUPAC name of 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine (CID 22417877) is 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine.
What is the SMILES notation for 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine?
The canonical SMILES for 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine is Nc1ccc2nc(-c3ccccc3)cc(Nc3ccc(F)c(F)c3)c2c1.
What is the InChIKey of 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine?
The InChIKey is BFHDIFIBCIIWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F2N3/c22-17-8-7-15(11-18(17)23)25-21-12-20(13-4-2-1-3-5-13)26-19-9-6-14(24)10-16(19)21/h1-12H,24H2,(H,25,26).
What are the key properties of 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine?
4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine has a molecular weight of 347.37 g/mol, XLogP of 5.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3,4-difluorophenyl)-2-phenylquinoline-4,6-diamine is sourced from PubChem (CID 22417877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).