About 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide
4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide (PubChem CID 22417951) has the molecular formula C15H21BrN2O2
and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide.
Molecular Properties
| Compound Name | 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide |
| PubChem CID | 22417951 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide |
| SMILES | Br.O.Oc1ccc2nccc(NC3CCCCC3)c2c1 |
| InChI | InChI=1S/C15H18N2O.BrH.H2O/c18-12-6-7-14-13(10-12)15(8-9-16-14)17-11-4-2-1-3-5-11;;/h6-11,18H,1-5H2,(H,16,17);1H;1H2 |
| InChIKey | RUNNMBQIKWTSMT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide?
The IUPAC name of 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide (CID 22417951) is 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide.
What is the SMILES notation for 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide?
The canonical SMILES for 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide is Br.O.Oc1ccc2nccc(NC3CCCCC3)c2c1.
What is the InChIKey of 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide?
The InChIKey is RUNNMBQIKWTSMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.BrH.H2O/c18-12-6-7-14-13(10-12)15(8-9-16-14)17-11-4-2-1-3-5-11;;/h6-11,18H,1-5H2,(H,16,17);1H;1H2.
What are the key properties of 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide?
4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide has a molecular weight of 341.25 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylamino)quinolin-6-ol;hydrate;hydrobromide is sourced from PubChem (CID 22417951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).