C18H14N4O2 — CID 22417966
4-[(7-methyl-1H-pyrazolo[5,4-f]quinolin-9-yl)amino]benzoic acid (PubChem CID 22417966) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-[(7-methyl-1H-pyrazolo[5,4-f]quinolin-9-yl)amino]benzoic acid.
| Compound Name | 4-[(7-methyl-1H-pyrazolo[5,4-f]quinolin-9-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 22417966 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-[(7-methyl-1H-pyrazolo[5,4-f]quinolin-9-yl)amino]benzoic acid |
| SMILES | Cc1cc(Nc2ccc(C(=O)O)cc2)c2c(ccc3cn[nH]c32)n1 |
| InChI | InChI=1S/C18H14N4O2/c1-10-8-15(21-13-5-2-11(3-6-13)18(23)24)16-14(20-10)7-4-12-9-19-22-17(12)16/h2-9H,1H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | ZGYLVURUTXCXHB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |