C23H20ClN7 — CID 22418052
5-chloro-2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine (PubChem CID 22418052) has the molecular formula C23H20ClN7 and a molecular weight of 429.92 g/mol. Its IUPAC name is 5-chloro-2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 22418052 |
| Molecular Formula | C23H20ClN7 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-chloro-2-ethyl-7-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(Cl)nc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H20ClN7/c1-3-20-26-21-14(2)12-19(24)25-23(21)31(20)13-15-8-10-16(11-9-15)17-6-4-5-7-18(17)22-27-29-30-28-22/h4-12H,3,13H2,1-2H3,(H,27,28,29,30) |
| InChIKey | IOJJNSBFOVPVSG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|