About 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride
4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride (PubChem CID 22418882) has the molecular formula C15H32Cl2N2O3
and a molecular weight of 359.34 g/mol. Its IUPAC name is 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride.
Molecular Properties
| Compound Name | 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride |
| PubChem CID | 22418882 |
| Molecular Formula | C15H32Cl2N2O3 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride |
| SMILES | Cl.Cl.NC(CC1CCCCC1)C(O)C(O)CN1CCOCC1 |
| InChI | InChI=1S/C15H30N2O3.2ClH/c16-13(10-12-4-2-1-3-5-12)15(19)14(18)11-17-6-8-20-9-7-17;;/h12-15,18-19H,1-11,16H2;2*1H |
| InChIKey | PRYWBOAMFVNMHB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride?
The IUPAC name of 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride (CID 22418882) is 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride.
What is the SMILES notation for 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride?
The canonical SMILES for 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride is Cl.Cl.NC(CC1CCCCC1)C(O)C(O)CN1CCOCC1.
What is the InChIKey of 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride?
The InChIKey is PRYWBOAMFVNMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O3.2ClH/c16-13(10-12-4-2-1-3-5-12)15(19)14(18)11-17-6-8-20-9-7-17;;/h12-15,18-19H,1-11,16H2;2*1H.
What are the key properties of 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride?
4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride has a molecular weight of 359.34 g/mol, XLogP of 1.18, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol;dihydrochloride is sourced from PubChem (CID 22418882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).