About (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide
(2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 22419037) has the molecular formula C17H16F2N2O3
and a molecular weight of 334.32 g/mol. Its IUPAC name is (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide.
Molecular Properties
| Compound Name | (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| PubChem CID | 22419037 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1COc1c(F)cccc1F |
| InChI | InChI=1S/C17H16F2N2O3/c1-20-17(22)15(21-23-2)12-7-4-3-6-11(12)10-24-16-13(18)8-5-9-14(16)19/h3-9H,10H2,1-2H3,(H,20,22)/b21-15+ |
| InChIKey | IZGJHROGGAJGRQ-RCCKNPSSSA-N |
| XLogP | 2.64 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide?
The IUPAC name of (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide (CID 22419037) is (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide.
What is the SMILES notation for (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide?
The canonical SMILES for (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide is CNC(=O)/C(=N/OC)c1ccccc1COc1c(F)cccc1F.
What is the InChIKey of (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide?
The InChIKey is IZGJHROGGAJGRQ-RCCKNPSSSA-N. The full InChI is InChI=1S/C17H16F2N2O3/c1-20-17(22)15(21-23-2)12-7-4-3-6-11(12)10-24-16-13(18)8-5-9-14(16)19/h3-9H,10H2,1-2H3,(H,20,22)/b21-15+.
What are the key properties of (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide?
(2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide has a molecular weight of 334.32 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[2-[(2,6-difluorophenoxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide is sourced from PubChem (CID 22419037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).