About 2,4-diethyl-5-methylbenzene-1,3-diamine
2,4-diethyl-5-methylbenzene-1,3-diamine (PubChem CID 22419268) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,4-diethyl-5-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2,4-diethyl-5-methylbenzene-1,3-diamine |
| PubChem CID | 22419268 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2,4-diethyl-5-methylbenzene-1,3-diamine |
| SMILES | CCc1c(C)cc(N)c(CC)c1N |
| InChI | InChI=1S/C11H18N2/c1-4-8-7(3)6-10(12)9(5-2)11(8)13/h6H,4-5,12-13H2,1-3H3 |
| InChIKey | OHJDDRJXKMWSFJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethyl-5-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-5-methylbenzene-1,3-diamine?
The IUPAC name of 2,4-diethyl-5-methylbenzene-1,3-diamine (CID 22419268) is 2,4-diethyl-5-methylbenzene-1,3-diamine.
What is the SMILES notation for 2,4-diethyl-5-methylbenzene-1,3-diamine?
The canonical SMILES for 2,4-diethyl-5-methylbenzene-1,3-diamine is CCc1c(C)cc(N)c(CC)c1N.
What is the InChIKey of 2,4-diethyl-5-methylbenzene-1,3-diamine?
The InChIKey is OHJDDRJXKMWSFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-8-7(3)6-10(12)9(5-2)11(8)13/h6H,4-5,12-13H2,1-3H3.
What are the key properties of 2,4-diethyl-5-methylbenzene-1,3-diamine?
2,4-diethyl-5-methylbenzene-1,3-diamine has a molecular weight of 178.28 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-5-methylbenzene-1,3-diamine is sourced from PubChem (CID 22419268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).