About 2-methyl-1-propyl-2,3-dihydropyrrole
2-methyl-1-propyl-2,3-dihydropyrrole (PubChem CID 22419373) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 2-methyl-1-propyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 2-methyl-1-propyl-2,3-dihydropyrrole |
| PubChem CID | 22419373 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 2-methyl-1-propyl-2,3-dihydropyrrole |
| SMILES | CCCN1C=CCC1C |
| InChI | InChI=1S/C8H15N/c1-3-6-9-7-4-5-8(9)2/h4,7-8H,3,5-6H2,1-2H3 |
| InChIKey | FUCHROSBEJANCF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1-propyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propyl-2,3-dihydropyrrole?
The IUPAC name of 2-methyl-1-propyl-2,3-dihydropyrrole (CID 22419373) is 2-methyl-1-propyl-2,3-dihydropyrrole.
What is the SMILES notation for 2-methyl-1-propyl-2,3-dihydropyrrole?
The canonical SMILES for 2-methyl-1-propyl-2,3-dihydropyrrole is CCCN1C=CCC1C.
What is the InChIKey of 2-methyl-1-propyl-2,3-dihydropyrrole?
The InChIKey is FUCHROSBEJANCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-3-6-9-7-4-5-8(9)2/h4,7-8H,3,5-6H2,1-2H3.
What are the key properties of 2-methyl-1-propyl-2,3-dihydropyrrole?
2-methyl-1-propyl-2,3-dihydropyrrole has a molecular weight of 125.21 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propyl-2,3-dihydropyrrole is sourced from PubChem (CID 22419373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).