About 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine
1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine (PubChem CID 22419921) has the molecular formula C10H13N3O2S2
and a molecular weight of 271.37 g/mol. Its IUPAC name is 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine |
| PubChem CID | 22419921 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine |
| SMILES | Cc1ccc(S(=O)(=O)C(N)CN)c2scnc12 |
| InChI | InChI=1S/C10H13N3O2S2/c1-6-2-3-7(10-9(6)13-5-16-10)17(14,15)8(12)4-11/h2-3,5,8H,4,11-12H2,1H3 |
| InChIKey | APGIJSNHQPFKRE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine?
The IUPAC name of 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine (CID 22419921) is 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine.
What is the SMILES notation for 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine?
The canonical SMILES for 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine is Cc1ccc(S(=O)(=O)C(N)CN)c2scnc12.
What is the InChIKey of 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine?
The InChIKey is APGIJSNHQPFKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S2/c1-6-2-3-7(10-9(6)13-5-16-10)17(14,15)8(12)4-11/h2-3,5,8H,4,11-12H2,1H3.
What are the key properties of 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine?
1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine has a molecular weight of 271.37 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-1,3-benzothiazol-7-yl)sulfonyl]ethane-1,2-diamine is sourced from PubChem (CID 22419921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).